Survey
* Your assessment is very important for improving the work of artificial intelligence, which forms the content of this project
* Your assessment is very important for improving the work of artificial intelligence, which forms the content of this project
1. N-Alkylamides 1.1. Structure 1.2. Occurrence 1.3. Objective 2. Database CHEMICAL-FUNCTIONAL SPACE EXPLORATION OF PLANT N-ALKYLAMIDES 3. Clustering 4. Conclusions Jente Boonen1, Vikas Sharma2, Vinot Dixit2 and Bart De Spiegeleer1* 1 Drug Quality and Registration (DruQuaR) group, Faculty of Pharmaceutical Sciences, Ghent University, Harelbekestraat 72, B-9000 Ghent, Belgium 2 Department of Pharmaceutical Sciences, Dr. H.S. Gour University, Sagar 470003 M.P. India. *Corresponding author: Tel.: +32 9 264 8100; Fax: +32 9 264 8193, E-mail: Bart.DeSpiegeleer@UGent.be 2011-240b 1. N-Alkylamides 1.1. Structure 1.2. Occurrence 1.3. Objective 2. Database R1= 3. Clustering Aliphatic, often unsaturated units, w/wo substutients (N, O, S, cyclic,…) or in cyclic system with R2. 4. Conclusions O R 1 R 2 N R 3 R2= Aliphatic, often isobutylamide, methylbutylamide, phenylethylamide, tyramide, piperidide or pyrrolidide derivative, w/wo substituents (N, O, S, cyclic,…) or in cyclic system with R1. R3= Mostly H, Me, MeO, OH function. New group of potential drugs related to lipoid peptides (antiinflammatory, immunostimulant, anti-hepatotoxic, anti-oxidant, tingling, CB2 endocannabinomimetic, anti-microbial,…) May 2011 Now: 9 different plant families CH3 CH3 O O O NH CH3 CH3 O H3C O H3C 1. N-Alkylamides 1.1. Structure CH3 NH CH3 N 1.2. Occurrence 1.3. Objective 2. Database CH3 O Ceramides OH Ergopeptides 3. Clustering NH N CH3 4. Conclusions R= aliphatic chain HN May 2011 1. N-Alkylamides 1.1. Structure 1.2. Occurrence 1.3. Objective 2. Database Plant species ? ? N-alkylamide Functionality ? Interdisciplinary 3. Clustering 4. Conclusions No structured overview of plant N-alkylamides DATABASE CHEMICAL CLUSTERING May 2011 Relational database, now containing ± 300 plant N-alkylamides O H3C CH3 NH CH3 CC(C)CNC(=O)\C=C\CC/C=C\C=C\C C14H23NO deca-2E,6Z,8E-trienoic acid isobutylamide (2E,4E,8E)-N-butan-2-yldeca-2,4,8-trienamide spilanthol or affinin 1. N-Alkylamides 2. Database 3. Clustering 4. Conclusions Asteraceae Helianthea Spilanthes acmella Anti-oxidant EC50=1.38 µmol May 2011 1. N-Alkylamides 3D structure optimization 2. Database - Calculation and selection of 141 descriptors Constitutional descriptors WHIM descriptors Molecular properties 3. Clustering 4. Conclusions - Data-scaling transformation: zi = (хi – x)/SD - Multivariate analysis: Hierarchical cluster analysis (HCA) Principal compontent analysis (PCA) May 2011 1. N-Alkylamides 2. Database 3. Clustering 4. Conclusions HCA => Dendrogram PCA => PC1_PC2 (4 PCs for >70% Q²) May 2011 1. N-Alkylamides 4. Conclusions Loading plot 3. Clustering Scoring plot 2. Database N 1. N-Alkylamides «228» QUALITY ATTRIBUTES FOR CLUSTER: O 2. Database 3. Clustering 4. Conclusions CH3 OH (1) Constitutional AMW => molecular weight nAB, nBnZ, nCIC, nRO6 => aromatic ring structures (2) WHIM P2: shape L2: size E2: accessibility H3C CH3 O «220» N O CH3 (3) Molecular properties Ui => unsaturation index O H3C O CH3 N H O «193» May 2011 1. N-Alkylamides DATABASE => EXPLORATORY MINING 2. Database Chemical/functional overview of plant N-alkylamides 3. Clustering 4. Conclusions CLUSTERING Chemical similarities => Functionality Toxicity PK e.g. transdermal/transmucosal Justified choice of model compounds May 2011 Thank you for your attention May 2011